C25H28F3N5O2 — CID 151571022
2-[4-(2-aminoethyl)piperidine-1-carbonyl]-N'-hydroxy-1-[[4-(trifluoromethyl)phenyl]methyl]indole-6-carboximidamide (PubChem CID 151571022) has the molecular formula C25H28F3N5O2 and a molecular weight of 487.53 g/mol. Its IUPAC name is 2-[4-(2-aminoethyl)piperidine-1-carbonyl]-N'-hydroxy-1-[[4-(trifluoromethyl)phenyl]methyl]indole-6-carboximidamide.
| Compound Name | 2-[4-(2-aminoethyl)piperidine-1-carbonyl]-N'-hydroxy-1-[[4-(trifluoromethyl)phenyl]methyl]indole-6-carboximidamide |
|---|---|
| PubChem CID | 151571022 |
| Molecular Formula | C25H28F3N5O2 |
| Molecular Weight | 487.53 g/mol |
| Exact Mass | 487.22 |
| IUPAC Name | 2-[4-(2-aminoethyl)piperidine-1-carbonyl]-N'-hydroxy-1-[[4-(trifluoromethyl)phenyl]methyl]indole-6-carboximidamide |
| SMILES | NCCC1CCN(C(=O)c2cc3ccc(C(N)=NO)cc3n2Cc2ccc(C(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C25H28F3N5O2/c26-25(27,28)20-5-1-17(2-6-20)15-33-21-14-19(23(30)31-35)4-3-18(21)13-22(33)24(34)32-11-8-16(7-10-29)9-12-32/h1-6,13-14,16,35H,7-12,15,29H2,(H2,30,31) |
| InChIKey | QELHRTLBICKHOP-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 109.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.53 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|