C26H25BrN6O — CID 10864217
3-bromo-N,1-bis[(3-carbamimidoylphenyl)methyl]-4-methylindole-2-carboxamide (PubChem CID 10864217) has the molecular formula C26H25BrN6O and a molecular weight of 517.43 g/mol. Its IUPAC name is 3-bromo-N,1-bis[(3-carbamimidoylphenyl)methyl]-4-methylindole-2-carboxamide.
| Compound Name | 3-bromo-N,1-bis[(3-carbamimidoylphenyl)methyl]-4-methylindole-2-carboxamide |
|---|---|
| PubChem CID | 10864217 |
| Molecular Formula | C26H25BrN6O |
| Molecular Weight | 517.43 g/mol |
| Exact Mass | 516.13 |
| IUPAC Name | 3-bromo-N,1-bis[(3-carbamimidoylphenyl)methyl]-4-methylindole-2-carboxamide |
| SMILES | [H]/N=C(\N)c1cccc(CNC(=O)c2c(Br)c3c(C)cccc3n2Cc2cccc(/C(N)=N/[H])c2)c1 |
| InChI | InChI=1S/C26H25BrN6O/c1-15-5-2-10-20-21(15)22(27)23(33(20)14-17-7-4-9-19(12-17)25(30)31)26(34)32-13-16-6-3-8-18(11-16)24(28)29/h2-12H,13-14H2,1H3,(H3,28,29)(H3,30,31)(H,32,34) |
| InChIKey | JBQWITKJQABBAY-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 133.77 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.43 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|