C22H21N3O9 — CID 54121784
4-[[(2R)-1-[5-carbamimidoyl-2-(2-carboxy-2-oxoethyl)phenoxy]-3-carboxypropan-2-yl]carbamoyl]benzoic acid (PubChem CID 54121784) has the molecular formula C22H21N3O9 and a molecular weight of 471.42 g/mol. Its IUPAC name is 4-[[(2R)-1-[5-carbamimidoyl-2-(2-carboxy-2-oxoethyl)phenoxy]-3-carboxypropan-2-yl]carbamoyl]benzoic acid.
| Compound Name | 4-[[(2R)-1-[5-carbamimidoyl-2-(2-carboxy-2-oxoethyl)phenoxy]-3-carboxypropan-2-yl]carbamoyl]benzoic acid |
|---|---|
| PubChem CID | 54121784 |
| Molecular Formula | C22H21N3O9 |
| Molecular Weight | 471.42 g/mol |
| Exact Mass | 471.13 |
| IUPAC Name | 4-[[(2R)-1-[5-carbamimidoyl-2-(2-carboxy-2-oxoethyl)phenoxy]-3-carboxypropan-2-yl]carbamoyl]benzoic acid |
| SMILES | [H]/N=C(\N)c1ccc(CC(=O)C(=O)O)c(OC[C@@H](CC(=O)O)NC(=O)c2ccc(C(=O)O)cc2)c1 |
| InChI | InChI=1S/C22H21N3O9/c23-19(24)14-6-5-13(7-16(26)22(32)33)17(8-14)34-10-15(9-18(27)28)25-20(29)11-1-3-12(4-2-11)21(30)31/h1-6,8,15H,7,9-10H2,(H3,23,24)(H,25,29)(H,27,28)(H,30,31)(H,32,33)/t15-/m1/s1 |
| InChIKey | NOFKRVXNCHLBJU-OAHLLOKOSA-N |
| XLogP | 0.52 |
| TPSA | 217.17 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.42 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|