C29H32F6N6O10 — CID 87713830
3-[4-carbamimidoyl-2-[2-[[2-cyclopentyloxy-4-(diaminomethylideneamino)benzoyl]amino]ethoxy]phenyl]-2-oxopropanoic acid;bis(2,2,2-trifluoroacetic acid) (PubChem CID 87713830) has the molecular formula C29H32F6N6O10 and a molecular weight of 738.59 g/mol. Its IUPAC name is 3-[4-carbamimidoyl-2-[2-[[2-cyclopentyloxy-4-(diaminomethylideneamino)benzoyl]amino]ethoxy]phenyl]-2-oxopropanoic acid;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 3-[4-carbamimidoyl-2-[2-[[2-cyclopentyloxy-4-(diaminomethylideneamino)benzoyl]amino]ethoxy]phenyl]-2-oxopropanoic acid;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 87713830 |
| Molecular Formula | C29H32F6N6O10 |
| Molecular Weight | 738.59 g/mol |
| Exact Mass | 738.21 |
| IUPAC Name | 3-[4-carbamimidoyl-2-[2-[[2-cyclopentyloxy-4-(diaminomethylideneamino)benzoyl]amino]ethoxy]phenyl]-2-oxopropanoic acid;bis(2,2,2-trifluoroacetic acid) |
| SMILES | O=C(O)C(F)(F)F.O=C(O)C(F)(F)F.[H]/N=C(\N)c1ccc(CC(=O)C(=O)O)c(OCCNC(=O)c2ccc(N=C(N)N)cc2OC2CCCC2)c1 |
| InChI | InChI=1S/C25H30N6O6.2C2HF3O2/c26-22(27)15-6-5-14(11-19(32)24(34)35)20(12-15)36-10-9-30-23(33)18-8-7-16(31-25(28)29)13-21(18)37-17-3-1-2-4-17;2*3-2(4,5)1(6)7/h5-8,12-13,17H,1-4,9-11H2,(H3,26,27)(H,30,33)(H,34,35)(H4,28,29,31);2*(H,6,7) |
| InChIKey | JCUHYJOMVIJYAO-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 290.80 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 738.59 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|