C18H30N6O — CID 175354937
2-[2-cyclodecyloxy-5-(diaminomethylideneamino)phenyl]guanidine (PubChem CID 175354937) has the molecular formula C18H30N6O and a molecular weight of 346.48 g/mol. Its IUPAC name is 2-[2-cyclodecyloxy-5-(diaminomethylideneamino)phenyl]guanidine.
| Compound Name | 2-[2-cyclodecyloxy-5-(diaminomethylideneamino)phenyl]guanidine |
|---|---|
| PubChem CID | 175354937 |
| Molecular Formula | C18H30N6O |
| Molecular Weight | 346.48 g/mol |
| Exact Mass | 346.25 |
| IUPAC Name | 2-[2-cyclodecyloxy-5-(diaminomethylideneamino)phenyl]guanidine |
| SMILES | NC(N)=Nc1ccc(OC2CCCCCCCCC2)c(N=C(N)N)c1 |
| InChI | InChI=1S/C18H30N6O/c19-17(20)23-13-10-11-16(15(12-13)24-18(21)22)25-14-8-6-4-2-1-3-5-7-9-14/h10-12,14H,1-9H2,(H4,19,20,23)(H4,21,22,24) |
| InChIKey | LWVRMVRGFPCWJN-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 138.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.48 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|