About 4-chloro-2-cyclohexyloxy-N'-hydroxybenzenecarboximidamide
4-chloro-2-cyclohexyloxy-N'-hydroxybenzenecarboximidamide (PubChem CID 76985015) has the molecular formula C13H17ClN2O2
and a molecular weight of 268.74 g/mol. Its IUPAC name is 4-chloro-2-cyclohexyloxy-N'-hydroxybenzenecarboximidamide.
Molecular Properties
| Compound Name | 4-chloro-2-cyclohexyloxy-N'-hydroxybenzenecarboximidamide |
| PubChem CID | 76985015 |
| Molecular Formula | C13H17ClN2O2 |
| Molecular Weight | 268.74 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | 4-chloro-2-cyclohexyloxy-N'-hydroxybenzenecarboximidamide |
| SMILES | NC(=NO)c1ccc(Cl)cc1OC1CCCCC1 |
| InChI | InChI=1S/C13H17ClN2O2/c14-9-6-7-11(13(15)16-17)12(8-9)18-10-4-2-1-3-5-10/h6-8,10,17H,1-5H2,(H2,15,16) |
| InChIKey | DJWJMVWKZCJJLN-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 67.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.74 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-2-cyclohexyloxy-N'-hydroxybenzenecarboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-2-cyclohexyloxy-N'-hydroxybenzenecarboximidamide?
The IUPAC name of 4-chloro-2-cyclohexyloxy-N'-hydroxybenzenecarboximidamide (CID 76985015) is 4-chloro-2-cyclohexyloxy-N'-hydroxybenzenecarboximidamide.
What is the SMILES notation for 4-chloro-2-cyclohexyloxy-N'-hydroxybenzenecarboximidamide?
The canonical SMILES for 4-chloro-2-cyclohexyloxy-N'-hydroxybenzenecarboximidamide is NC(=NO)c1ccc(Cl)cc1OC1CCCCC1.
What is the InChIKey of 4-chloro-2-cyclohexyloxy-N'-hydroxybenzenecarboximidamide?
The InChIKey is DJWJMVWKZCJJLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17ClN2O2/c14-9-6-7-11(13(15)16-17)12(8-9)18-10-4-2-1-3-5-10/h6-8,10,17H,1-5H2,(H2,15,16).
What are the key properties of 4-chloro-2-cyclohexyloxy-N'-hydroxybenzenecarboximidamide?
4-chloro-2-cyclohexyloxy-N'-hydroxybenzenecarboximidamide has a molecular weight of 268.74 g/mol, XLogP of 3.15, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-2-cyclohexyloxy-N'-hydroxybenzenecarboximidamide is sourced from PubChem (CID 76985015), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).