C13H17ClN2O2 — CID 62496519
2-chloro-6-cyclohexyloxy-N'-hydroxybenzenecarboximidamide (PubChem CID 62496519) has the molecular formula C13H17ClN2O2 and a molecular weight of 268.74 g/mol. Its IUPAC name is 2-chloro-6-cyclohexyloxy-N'-hydroxybenzenecarboximidamide.
| Compound Name | 2-chloro-6-cyclohexyloxy-N'-hydroxybenzenecarboximidamide |
|---|---|
| PubChem CID | 62496519 |
| Molecular Formula | C13H17ClN2O2 |
| Molecular Weight | 268.74 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | 2-chloro-6-cyclohexyloxy-N'-hydroxybenzenecarboximidamide |
| SMILES | N/C(=N/O)c1c(Cl)cccc1OC1CCCCC1 |
| InChI | InChI=1S/C13H17ClN2O2/c14-10-7-4-8-11(12(10)13(15)16-17)18-9-5-2-1-3-6-9/h4,7-9,17H,1-3,5-6H2,(H2,15,16) |
| InChIKey | RCHCQIYCKHYAML-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 67.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.74 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|