C14H19BrN2O2 — CID 114904230
4-bromo-N'-hydroxy-2-(4-methylcyclohexyl)oxybenzenecarboximidamide (PubChem CID 114904230) has the molecular formula C14H19BrN2O2 and a molecular weight of 327.22 g/mol. Its IUPAC name is 4-bromo-N'-hydroxy-2-(4-methylcyclohexyl)oxybenzenecarboximidamide.
| Compound Name | 4-bromo-N'-hydroxy-2-(4-methylcyclohexyl)oxybenzenecarboximidamide |
|---|---|
| PubChem CID | 114904230 |
| Molecular Formula | C14H19BrN2O2 |
| Molecular Weight | 327.22 g/mol |
| Exact Mass | 326.06 |
| IUPAC Name | 4-bromo-N'-hydroxy-2-(4-methylcyclohexyl)oxybenzenecarboximidamide |
| SMILES | CC1CCC(Oc2cc(Br)ccc2/C(N)=N/O)CC1 |
| InChI | InChI=1S/C14H19BrN2O2/c1-9-2-5-11(6-3-9)19-13-8-10(15)4-7-12(13)14(16)17-18/h4,7-9,11,18H,2-3,5-6H2,1H3,(H2,16,17) |
| InChIKey | IDPSGTVQBYBSEI-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 67.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.22 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|