C13H17Cl2N3O2 — CID 23195924
3-chloro-4-cyclopentyloxy-N-(diaminomethylidene)benzamide;hydrochloride (PubChem CID 23195924) has the molecular formula C13H17Cl2N3O2 and a molecular weight of 318.20 g/mol. Its IUPAC name is 3-chloro-4-cyclopentyloxy-N-(diaminomethylidene)benzamide;hydrochloride.
| Compound Name | 3-chloro-4-cyclopentyloxy-N-(diaminomethylidene)benzamide;hydrochloride |
|---|---|
| PubChem CID | 23195924 |
| Molecular Formula | C13H17Cl2N3O2 |
| Molecular Weight | 318.20 g/mol |
| Exact Mass | 317.07 |
| IUPAC Name | 3-chloro-4-cyclopentyloxy-N-(diaminomethylidene)benzamide;hydrochloride |
| SMILES | Cl.NC(N)=NC(=O)c1ccc(OC2CCCC2)c(Cl)c1 |
| InChI | InChI=1S/C13H16ClN3O2.ClH/c14-10-7-8(12(18)17-13(15)16)5-6-11(10)19-9-3-1-2-4-9;/h5-7,9H,1-4H2,(H4,15,16,17,18);1H |
| InChIKey | ORRYCSWETQXYQB-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.20 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|