C15H16ClF2NO2 — CID 154632573
2-[3-chloro-4-(4,4-difluorocyclohexyl)oxyphenyl]prop-2-enamide (PubChem CID 154632573) has the molecular formula C15H16ClF2NO2 and a molecular weight of 315.75 g/mol. Its IUPAC name is 2-[3-chloro-4-(4,4-difluorocyclohexyl)oxyphenyl]prop-2-enamide.
| Compound Name | 2-[3-chloro-4-(4,4-difluorocyclohexyl)oxyphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 154632573 |
| Molecular Formula | C15H16ClF2NO2 |
| Molecular Weight | 315.75 g/mol |
| Exact Mass | 315.08 |
| IUPAC Name | 2-[3-chloro-4-(4,4-difluorocyclohexyl)oxyphenyl]prop-2-enamide |
| SMILES | C=C(C(N)=O)c1ccc(OC2CCC(F)(F)CC2)c(Cl)c1 |
| InChI | InChI=1S/C15H16ClF2NO2/c1-9(14(19)20)10-2-3-13(12(16)8-10)21-11-4-6-15(17,18)7-5-11/h2-3,8,11H,1,4-7H2,(H2,19,20) |
| InChIKey | ZVSLGBKGMUIZQH-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.75 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|