C21H19N5O4 — CID 22443708
2-[6-carbamimidoyl-2-[4-(diaminomethylideneamino)benzoyl]oxynaphthalen-1-yl]acetic acid (PubChem CID 22443708) has the molecular formula C21H19N5O4 and a molecular weight of 405.41 g/mol. Its IUPAC name is 2-[6-carbamimidoyl-2-[4-(diaminomethylideneamino)benzoyl]oxynaphthalen-1-yl]acetic acid.
| Compound Name | 2-[6-carbamimidoyl-2-[4-(diaminomethylideneamino)benzoyl]oxynaphthalen-1-yl]acetic acid |
|---|---|
| PubChem CID | 22443708 |
| Molecular Formula | C21H19N5O4 |
| Molecular Weight | 405.41 g/mol |
| Exact Mass | 405.14 |
| IUPAC Name | 2-[6-carbamimidoyl-2-[4-(diaminomethylideneamino)benzoyl]oxynaphthalen-1-yl]acetic acid |
| SMILES | [H]/N=C(\N)c1ccc2c(CC(=O)O)c(OC(=O)c3ccc(N=C(N)N)cc3)ccc2c1 |
| InChI | InChI=1S/C21H19N5O4/c22-19(23)13-3-7-15-12(9-13)4-8-17(16(15)10-18(27)28)30-20(29)11-1-5-14(6-2-11)26-21(24)25/h1-9H,10H2,(H3,22,23)(H,27,28)(H4,24,25,26) |
| InChIKey | VCKFPJOAJZVYQX-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 177.87 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.41 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|