C25H27N7O4 — CID 70130426
[1-(2-amino-2-oxoethyl)-6-carbamimidoylnaphthalen-2-yl] 4-[carbamimidoyl(morpholin-4-yl)amino]benzoate (PubChem CID 70130426) has the molecular formula C25H27N7O4 and a molecular weight of 489.54 g/mol. Its IUPAC name is [1-(2-amino-2-oxoethyl)-6-carbamimidoylnaphthalen-2-yl] 4-[carbamimidoyl(morpholin-4-yl)amino]benzoate.
| Compound Name | [1-(2-amino-2-oxoethyl)-6-carbamimidoylnaphthalen-2-yl] 4-[carbamimidoyl(morpholin-4-yl)amino]benzoate |
|---|---|
| PubChem CID | 70130426 |
| Molecular Formula | C25H27N7O4 |
| Molecular Weight | 489.54 g/mol |
| Exact Mass | 489.21 |
| IUPAC Name | [1-(2-amino-2-oxoethyl)-6-carbamimidoylnaphthalen-2-yl] 4-[carbamimidoyl(morpholin-4-yl)amino]benzoate |
| SMILES | [H]/N=C(\N)c1ccc2c(CC(N)=O)c(OC(=O)c3ccc(N(/C(N)=N/[H])N4CCOCC4)cc3)ccc2c1 |
| InChI | InChI=1S/C25H27N7O4/c26-22(33)14-20-19-7-3-17(23(27)28)13-16(19)4-8-21(20)36-24(34)15-1-5-18(6-2-15)32(25(29)30)31-9-11-35-12-10-31/h1-8,13H,9-12,14H2,(H2,26,33)(H3,27,28)(H3,29,30) |
| InChIKey | MANMAAWEOWUVOP-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 184.84 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.54 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|