About (2-benzoyl-4-carbamimidoylphenyl) benzoate;carbonic acid
(2-benzoyl-4-carbamimidoylphenyl) benzoate;carbonic acid (PubChem CID 70057851) has the molecular formula C22H18N2O6
and a molecular weight of 406.39 g/mol. Its IUPAC name is (2-benzoyl-4-carbamimidoylphenyl) benzoate;carbonic acid.
Molecular Properties
| Compound Name | (2-benzoyl-4-carbamimidoylphenyl) benzoate;carbonic acid |
| PubChem CID | 70057851 |
| Molecular Formula | C22H18N2O6 |
| Molecular Weight | 406.39 g/mol |
| Exact Mass | 406.12 |
| IUPAC Name | (2-benzoyl-4-carbamimidoylphenyl) benzoate;carbonic acid |
| SMILES | O=C(O)O.[H]/N=C(\N)c1ccc(OC(=O)c2ccccc2)c(C(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C21H16N2O3.CH2O3/c22-20(23)16-11-12-18(26-21(25)15-9-5-2-6-10-15)17(13-16)19(24)14-7-3-1-4-8-14;2-1(3)4/h1-13H,(H3,22,23);(H2,2,3,4) |
| InChIKey | REDOOHLDWPRKJK-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 150.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 406.39 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (2-benzoyl-4-carbamimidoylphenyl) benzoate;carbonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-benzoyl-4-carbamimidoylphenyl) benzoate;carbonic acid?
The IUPAC name of (2-benzoyl-4-carbamimidoylphenyl) benzoate;carbonic acid (CID 70057851) is (2-benzoyl-4-carbamimidoylphenyl) benzoate;carbonic acid.
What is the SMILES notation for (2-benzoyl-4-carbamimidoylphenyl) benzoate;carbonic acid?
The canonical SMILES for (2-benzoyl-4-carbamimidoylphenyl) benzoate;carbonic acid is O=C(O)O.[H]/N=C(\N)c1ccc(OC(=O)c2ccccc2)c(C(=O)c2ccccc2)c1.
What is the InChIKey of (2-benzoyl-4-carbamimidoylphenyl) benzoate;carbonic acid?
The InChIKey is REDOOHLDWPRKJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H16N2O3.CH2O3/c22-20(23)16-11-12-18(26-21(25)15-9-5-2-6-10-15)17(13-16)19(24)14-7-3-1-4-8-14;2-1(3)4/h1-13H,(H3,22,23);(H2,2,3,4).
What are the key properties of (2-benzoyl-4-carbamimidoylphenyl) benzoate;carbonic acid?
(2-benzoyl-4-carbamimidoylphenyl) benzoate;carbonic acid has a molecular weight of 406.39 g/mol, XLogP of 3.64, 5 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-benzoyl-4-carbamimidoylphenyl) benzoate;carbonic acid is sourced from PubChem (CID 70057851), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).