About (2,4-dibromophenyl) 4-benzoylbenzoate
(2,4-dibromophenyl) 4-benzoylbenzoate (PubChem CID 2316078) has the molecular formula C20H12Br2O3
and a molecular weight of 460.12 g/mol. Its IUPAC name is (2,4-dibromophenyl) 4-benzoylbenzoate.
Molecular Properties
| Compound Name | (2,4-dibromophenyl) 4-benzoylbenzoate |
| PubChem CID | 2316078 |
| Molecular Formula | C20H12Br2O3 |
| Molecular Weight | 460.12 g/mol |
| Exact Mass | 457.92 |
| IUPAC Name | (2,4-dibromophenyl) 4-benzoylbenzoate |
| SMILES | O=C(Oc1ccc(Br)cc1Br)c1ccc(C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C20H12Br2O3/c21-16-10-11-18(17(22)12-16)25-20(24)15-8-6-14(7-9-15)19(23)13-4-2-1-3-5-13/h1-12H |
| InChIKey | NKMMMRUSSRNFHA-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 460.12 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (2,4-dibromophenyl) 4-benzoylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,4-dibromophenyl) 4-benzoylbenzoate?
The IUPAC name of (2,4-dibromophenyl) 4-benzoylbenzoate (CID 2316078) is (2,4-dibromophenyl) 4-benzoylbenzoate.
What is the SMILES notation for (2,4-dibromophenyl) 4-benzoylbenzoate?
The canonical SMILES for (2,4-dibromophenyl) 4-benzoylbenzoate is O=C(Oc1ccc(Br)cc1Br)c1ccc(C(=O)c2ccccc2)cc1.
What is the InChIKey of (2,4-dibromophenyl) 4-benzoylbenzoate?
The InChIKey is NKMMMRUSSRNFHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H12Br2O3/c21-16-10-11-18(17(22)12-16)25-20(24)15-8-6-14(7-9-15)19(23)13-4-2-1-3-5-13/h1-12H.
What are the key properties of (2,4-dibromophenyl) 4-benzoylbenzoate?
(2,4-dibromophenyl) 4-benzoylbenzoate has a molecular weight of 460.12 g/mol, XLogP of 5.66, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2,4-dibromophenyl) 4-benzoylbenzoate is sourced from PubChem (CID 2316078), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).