C27H14Br4O5 — CID 141250024
[2-(2-benzoyloxy-4,5-dibromobenzoyl)-4,5-dibromophenyl] benzoate (PubChem CID 141250024) has the molecular formula C27H14Br4O5 and a molecular weight of 738.02 g/mol. Its IUPAC name is [2-(2-benzoyloxy-4,5-dibromobenzoyl)-4,5-dibromophenyl] benzoate.
| Compound Name | [2-(2-benzoyloxy-4,5-dibromobenzoyl)-4,5-dibromophenyl] benzoate |
|---|---|
| PubChem CID | 141250024 |
| Molecular Formula | C27H14Br4O5 |
| Molecular Weight | 738.02 g/mol |
| Exact Mass | 733.76 |
| IUPAC Name | [2-(2-benzoyloxy-4,5-dibromobenzoyl)-4,5-dibromophenyl] benzoate |
| SMILES | O=C(Oc1cc(Br)c(Br)cc1C(=O)c1cc(Br)c(Br)cc1OC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H14Br4O5/c28-19-11-17(23(13-21(19)30)35-26(33)15-7-3-1-4-8-15)25(32)18-12-20(29)22(31)14-24(18)36-27(34)16-9-5-2-6-10-16/h1-14H |
| InChIKey | SBCVIHZQRYAHAF-UHFFFAOYSA-N |
| XLogP | 8.41 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 738.02 |
| LogP ≤ 5 | 8.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|