C24H27N5O2 — CID 134379665
[6-carbamimidoyl-3-(2,2-dimethylpropyl)naphthalen-2-yl] 4-(diaminomethylideneamino)benzoate (PubChem CID 134379665) has the molecular formula C24H27N5O2 and a molecular weight of 417.51 g/mol. Its IUPAC name is [6-carbamimidoyl-3-(2,2-dimethylpropyl)naphthalen-2-yl] 4-(diaminomethylideneamino)benzoate.
| Compound Name | [6-carbamimidoyl-3-(2,2-dimethylpropyl)naphthalen-2-yl] 4-(diaminomethylideneamino)benzoate |
|---|---|
| PubChem CID | 134379665 |
| Molecular Formula | C24H27N5O2 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.22 |
| IUPAC Name | [6-carbamimidoyl-3-(2,2-dimethylpropyl)naphthalen-2-yl] 4-(diaminomethylideneamino)benzoate |
| SMILES | [H]/N=C(\N)c1ccc2cc(OC(=O)c3ccc(N=C(N)N)cc3)c(CC(C)(C)C)cc2c1 |
| InChI | InChI=1S/C24H27N5O2/c1-24(2,3)13-18-11-17-10-16(21(25)26)5-4-15(17)12-20(18)31-22(30)14-6-8-19(9-7-14)29-23(27)28/h4-12H,13H2,1-3H3,(H3,25,26)(H4,27,28,29) |
| InChIKey | VQUVATZCPSKAJM-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 140.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|