C19H17N5O2 — CID 70060032
(6-carbamimidoylnaphthalen-2-yl) 2-(diaminomethylideneamino)benzoate (PubChem CID 70060032) has the molecular formula C19H17N5O2 and a molecular weight of 347.38 g/mol. Its IUPAC name is (6-carbamimidoylnaphthalen-2-yl) 2-(diaminomethylideneamino)benzoate.
| Compound Name | (6-carbamimidoylnaphthalen-2-yl) 2-(diaminomethylideneamino)benzoate |
|---|---|
| PubChem CID | 70060032 |
| Molecular Formula | C19H17N5O2 |
| Molecular Weight | 347.38 g/mol |
| Exact Mass | 347.14 |
| IUPAC Name | (6-carbamimidoylnaphthalen-2-yl) 2-(diaminomethylideneamino)benzoate |
| SMILES | [H]/N=C(\N)c1ccc2cc(OC(=O)c3ccccc3N=C(N)N)ccc2c1 |
| InChI | InChI=1S/C19H17N5O2/c20-17(21)13-6-5-12-10-14(8-7-11(12)9-13)26-18(25)15-3-1-2-4-16(15)24-19(22)23/h1-10H,(H3,20,21)(H4,22,23,24) |
| InChIKey | MWUNNOBYPACWNR-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 140.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.38 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|