C23H26Cl2N6O4 — CID 70130898
[1-(2-amino-2-oxoethyl)-6-carbamimidoylnaphthalen-2-yl] 4-[carbamimidoyl(2-hydroxyethyl)amino]benzoate;dihydrochloride (PubChem CID 70130898) has the molecular formula C23H26Cl2N6O4 and a molecular weight of 521.41 g/mol. Its IUPAC name is [1-(2-amino-2-oxoethyl)-6-carbamimidoylnaphthalen-2-yl] 4-[carbamimidoyl(2-hydroxyethyl)amino]benzoate;dihydrochloride.
| Compound Name | [1-(2-amino-2-oxoethyl)-6-carbamimidoylnaphthalen-2-yl] 4-[carbamimidoyl(2-hydroxyethyl)amino]benzoate;dihydrochloride |
|---|---|
| PubChem CID | 70130898 |
| Molecular Formula | C23H26Cl2N6O4 |
| Molecular Weight | 521.41 g/mol |
| Exact Mass | 520.14 |
| IUPAC Name | [1-(2-amino-2-oxoethyl)-6-carbamimidoylnaphthalen-2-yl] 4-[carbamimidoyl(2-hydroxyethyl)amino]benzoate;dihydrochloride |
| SMILES | Cl.Cl.[H]/N=C(\N)c1ccc2c(CC(N)=O)c(OC(=O)c3ccc(N(CCO)/C(N)=N/[H])cc3)ccc2c1 |
| InChI | InChI=1S/C23H24N6O4.2ClH/c24-20(31)12-18-17-7-3-15(21(25)26)11-14(17)4-8-19(18)33-22(32)13-1-5-16(6-2-13)29(9-10-30)23(27)28;;/h1-8,11,30H,9-10,12H2,(H2,24,31)(H3,25,26)(H3,27,28);2*1H |
| InChIKey | NRYMHDYRSHSKSG-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 192.60 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.41 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|