C27H31N7O4 — CID 86753970
[1-(2-amino-2-oxoethyl)-6-carbamimidoylnaphthalen-2-yl] 4-[[2-(2-morpholin-4-ylethyl)hydrazinyl]methylideneamino]benzoate (PubChem CID 86753970) has the molecular formula C27H31N7O4 and a molecular weight of 517.59 g/mol. Its IUPAC name is [1-(2-amino-2-oxoethyl)-6-carbamimidoylnaphthalen-2-yl] 4-[[2-(2-morpholin-4-ylethyl)hydrazinyl]methylideneamino]benzoate.
| Compound Name | [1-(2-amino-2-oxoethyl)-6-carbamimidoylnaphthalen-2-yl] 4-[[2-(2-morpholin-4-ylethyl)hydrazinyl]methylideneamino]benzoate |
|---|---|
| PubChem CID | 86753970 |
| Molecular Formula | C27H31N7O4 |
| Molecular Weight | 517.59 g/mol |
| Exact Mass | 517.24 |
| IUPAC Name | [1-(2-amino-2-oxoethyl)-6-carbamimidoylnaphthalen-2-yl] 4-[[2-(2-morpholin-4-ylethyl)hydrazinyl]methylideneamino]benzoate |
| SMILES | [H]/N=C(\N)c1ccc2c(CC(N)=O)c(OC(=O)c3ccc(/N=C/NNCCN4CCOCC4)cc3)ccc2c1 |
| InChI | InChI=1S/C27H31N7O4/c28-25(35)16-23-22-7-3-20(26(29)30)15-19(22)4-8-24(23)38-27(36)18-1-5-21(6-2-18)31-17-33-32-9-10-34-11-13-37-14-12-34/h1-8,15,17,32H,9-14,16H2,(H2,28,35)(H3,29,30)(H,31,33) |
| InChIKey | GMNQSTCELQWXMG-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 168.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.59 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|