C29H35N7O4 — CID 139755227
[1-(2-amino-2-oxoethyl)-6-carbamimidoylnaphthalen-2-yl] 4-[[(E)-(3-morpholin-4-ylpropylamino)methylideneamino]methylamino]benzoate (PubChem CID 139755227) has the molecular formula C29H35N7O4 and a molecular weight of 545.64 g/mol. Its IUPAC name is [1-(2-amino-2-oxoethyl)-6-carbamimidoylnaphthalen-2-yl] 4-[[(E)-(3-morpholin-4-ylpropylamino)methylideneamino]methylamino]benzoate.
| Compound Name | [1-(2-amino-2-oxoethyl)-6-carbamimidoylnaphthalen-2-yl] 4-[[(E)-(3-morpholin-4-ylpropylamino)methylideneamino]methylamino]benzoate |
|---|---|
| PubChem CID | 139755227 |
| Molecular Formula | C29H35N7O4 |
| Molecular Weight | 545.64 g/mol |
| Exact Mass | 545.28 |
| IUPAC Name | [1-(2-amino-2-oxoethyl)-6-carbamimidoylnaphthalen-2-yl] 4-[[(E)-(3-morpholin-4-ylpropylamino)methylideneamino]methylamino]benzoate |
| SMILES | [H]/N=C(\N)c1ccc2c(CC(N)=O)c(OC(=O)c3ccc(NC/N=C/NCCCN4CCOCC4)cc3)ccc2c1 |
| InChI | InChI=1S/C29H35N7O4/c30-27(37)17-25-24-8-4-22(28(31)32)16-21(24)5-9-26(25)40-29(38)20-2-6-23(7-3-20)35-19-34-18-33-10-1-11-36-12-14-39-15-13-36/h2-9,16,18,35H,1,10-15,17,19H2,(H2,30,37)(H3,31,32)(H,33,34) |
| InChIKey | KWECPADZRNNMSA-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 168.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.64 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|