C26H29N7O4 — CID 86753966
[1-(2-amino-2-oxoethyl)-6-carbamimidoylnaphthalen-2-yl] 4-[[(2-acetamidoethylamino)methylideneamino]methylamino]benzoate (PubChem CID 86753966) has the molecular formula C26H29N7O4 and a molecular weight of 503.56 g/mol. Its IUPAC name is [1-(2-amino-2-oxoethyl)-6-carbamimidoylnaphthalen-2-yl] 4-[[(2-acetamidoethylamino)methylideneamino]methylamino]benzoate.
| Compound Name | [1-(2-amino-2-oxoethyl)-6-carbamimidoylnaphthalen-2-yl] 4-[[(2-acetamidoethylamino)methylideneamino]methylamino]benzoate |
|---|---|
| PubChem CID | 86753966 |
| Molecular Formula | C26H29N7O4 |
| Molecular Weight | 503.56 g/mol |
| Exact Mass | 503.23 |
| IUPAC Name | [1-(2-amino-2-oxoethyl)-6-carbamimidoylnaphthalen-2-yl] 4-[[(2-acetamidoethylamino)methylideneamino]methylamino]benzoate |
| SMILES | [H]/N=C(\N)c1ccc2c(CC(N)=O)c(OC(=O)c3ccc(NCN=CNCCNC(C)=O)cc3)ccc2c1 |
| InChI | InChI=1S/C26H29N7O4/c1-16(34)32-11-10-30-14-31-15-33-20-6-2-17(3-7-20)26(36)37-23-9-5-18-12-19(25(28)29)4-8-21(18)22(23)13-24(27)35/h2-9,12,14,33H,10-11,13,15H2,1H3,(H2,27,35)(H3,28,29)(H,30,31)(H,32,34) |
| InChIKey | YXZXCOXFUWBRAT-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 184.78 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.56 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|