C23H24Cl2N6O3 — CID 70136932
[1-(2-amino-2-oxoethyl)-6-carbamimidoylnaphthalen-2-yl] 4-(4,5-dihydro-1H-imidazol-2-ylamino)benzoate;dihydrochloride (PubChem CID 70136932) has the molecular formula C23H24Cl2N6O3 and a molecular weight of 503.39 g/mol. Its IUPAC name is [1-(2-amino-2-oxoethyl)-6-carbamimidoylnaphthalen-2-yl] 4-(4,5-dihydro-1H-imidazol-2-ylamino)benzoate;dihydrochloride.
| Compound Name | [1-(2-amino-2-oxoethyl)-6-carbamimidoylnaphthalen-2-yl] 4-(4,5-dihydro-1H-imidazol-2-ylamino)benzoate;dihydrochloride |
|---|---|
| PubChem CID | 70136932 |
| Molecular Formula | C23H24Cl2N6O3 |
| Molecular Weight | 503.39 g/mol |
| Exact Mass | 502.13 |
| IUPAC Name | [1-(2-amino-2-oxoethyl)-6-carbamimidoylnaphthalen-2-yl] 4-(4,5-dihydro-1H-imidazol-2-ylamino)benzoate;dihydrochloride |
| SMILES | Cl.Cl.[H]/N=C(\N)c1ccc2c(CC(N)=O)c(OC(=O)c3ccc(NC4=NCCN4)cc3)ccc2c1 |
| InChI | InChI=1S/C23H22N6O3.2ClH/c24-20(30)12-18-17-7-3-15(21(25)26)11-14(17)4-8-19(18)32-22(31)13-1-5-16(6-2-13)29-23-27-9-10-28-23;;/h1-8,11H,9-10,12H2,(H2,24,30)(H3,25,26)(H2,27,28,29);2*1H |
| InChIKey | ZWMVBEKMECRVJK-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 155.68 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.39 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|