C22H21N5O2 — CID 10023093
(6-carbamimidoylnaphthalen-2-yl) 4-[(1-methyl-4,5-dihydroimidazol-2-yl)amino]benzoate (PubChem CID 10023093) has the molecular formula C22H21N5O2 and a molecular weight of 387.44 g/mol. Its IUPAC name is (6-carbamimidoylnaphthalen-2-yl) 4-[(1-methyl-4,5-dihydroimidazol-2-yl)amino]benzoate.
| Compound Name | (6-carbamimidoylnaphthalen-2-yl) 4-[(1-methyl-4,5-dihydroimidazol-2-yl)amino]benzoate |
|---|---|
| PubChem CID | 10023093 |
| Molecular Formula | C22H21N5O2 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.17 |
| IUPAC Name | (6-carbamimidoylnaphthalen-2-yl) 4-[(1-methyl-4,5-dihydroimidazol-2-yl)amino]benzoate |
| SMILES | [H]/N=C(\N)c1ccc2cc(OC(=O)c3ccc(NC4=NCCN4C)cc3)ccc2c1 |
| InChI | InChI=1S/C22H21N5O2/c1-27-11-10-25-22(27)26-18-7-4-14(5-8-18)21(28)29-19-9-6-15-12-17(20(23)24)3-2-16(15)13-19/h2-9,12-13H,10-11H2,1H3,(H3,23,24)(H,25,26) |
| InChIKey | LCIVPCPCNRFJML-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 103.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|