C21H24N6O7S — CID 21300509
5-[5-carbamimidoyl-2-(2-carboxy-2-oxoethyl)phenoxy]-4-[[5-(diaminomethylideneamino)thiophene-2-carbonyl]amino]pentanoic acid (PubChem CID 21300509) has the molecular formula C21H24N6O7S and a molecular weight of 504.53 g/mol. Its IUPAC name is 5-[5-carbamimidoyl-2-(2-carboxy-2-oxoethyl)phenoxy]-4-[[5-(diaminomethylideneamino)thiophene-2-carbonyl]amino]pentanoic acid.
| Compound Name | 5-[5-carbamimidoyl-2-(2-carboxy-2-oxoethyl)phenoxy]-4-[[5-(diaminomethylideneamino)thiophene-2-carbonyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 21300509 |
| Molecular Formula | C21H24N6O7S |
| Molecular Weight | 504.53 g/mol |
| Exact Mass | 504.14 |
| IUPAC Name | 5-[5-carbamimidoyl-2-(2-carboxy-2-oxoethyl)phenoxy]-4-[[5-(diaminomethylideneamino)thiophene-2-carbonyl]amino]pentanoic acid |
| SMILES | [H]/N=C(\N)c1ccc(CC(=O)C(=O)O)c(OCC(CCC(=O)O)NC(=O)c2ccc(N=C(N)N)s2)c1 |
| InChI | InChI=1S/C21H24N6O7S/c22-18(23)11-2-1-10(7-13(28)20(32)33)14(8-11)34-9-12(3-6-17(29)30)26-19(31)15-4-5-16(35-15)27-21(24)25/h1-2,4-5,8,12H,3,6-7,9H2,(H3,22,23)(H,26,31)(H,29,30)(H,32,33)(H4,24,25,27) |
| InChIKey | DNHMXPYNLJMURC-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 244.27 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.53 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|