C24H26N6O8 — CID 21300505
5-[5-carbamimidoyl-2-(2-carboxy-2-oxoethyl)phenoxy]-4-[[4-(diaminomethylidenecarbamoyl)benzoyl]amino]pentanoic acid (PubChem CID 21300505) has the molecular formula C24H26N6O8 and a molecular weight of 526.51 g/mol. Its IUPAC name is 5-[5-carbamimidoyl-2-(2-carboxy-2-oxoethyl)phenoxy]-4-[[4-(diaminomethylidenecarbamoyl)benzoyl]amino]pentanoic acid.
| Compound Name | 5-[5-carbamimidoyl-2-(2-carboxy-2-oxoethyl)phenoxy]-4-[[4-(diaminomethylidenecarbamoyl)benzoyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 21300505 |
| Molecular Formula | C24H26N6O8 |
| Molecular Weight | 526.51 g/mol |
| Exact Mass | 526.18 |
| IUPAC Name | 5-[5-carbamimidoyl-2-(2-carboxy-2-oxoethyl)phenoxy]-4-[[4-(diaminomethylidenecarbamoyl)benzoyl]amino]pentanoic acid |
| SMILES | [H]/N=C(\N)c1ccc(CC(=O)C(=O)O)c(OCC(CCC(=O)O)NC(=O)c2ccc(C(=O)N=C(N)N)cc2)c1 |
| InChI | InChI=1S/C24H26N6O8/c25-20(26)15-6-5-14(9-17(31)23(36)37)18(10-15)38-11-16(7-8-19(32)33)29-21(34)12-1-3-13(4-2-12)22(35)30-24(27)28/h1-6,10,16H,7-9,11H2,(H3,25,26)(H,29,34)(H,32,33)(H,36,37)(H4,27,28,30,35) |
| InChIKey | OVNLNFPFJXJUBZ-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 261.34 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.51 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|