C17H17N3O3 — CID 70098656
3-[3-[(3-carbamimidoylbenzoyl)amino]phenyl]propanoic acid (PubChem CID 70098656) has the molecular formula C17H17N3O3 and a molecular weight of 311.34 g/mol. Its IUPAC name is 3-[3-[(3-carbamimidoylbenzoyl)amino]phenyl]propanoic acid.
| Compound Name | 3-[3-[(3-carbamimidoylbenzoyl)amino]phenyl]propanoic acid |
|---|---|
| PubChem CID | 70098656 |
| Molecular Formula | C17H17N3O3 |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | 3-[3-[(3-carbamimidoylbenzoyl)amino]phenyl]propanoic acid |
| SMILES | [H]/N=C(\N)c1cccc(C(=O)Nc2cccc(CCC(=O)O)c2)c1 |
| InChI | InChI=1S/C17H17N3O3/c18-16(19)12-4-2-5-13(10-12)17(23)20-14-6-1-3-11(9-14)7-8-15(21)22/h1-6,9-10H,7-8H2,(H3,18,19)(H,20,23)(H,21,22) |
| InChIKey | NAWLCEWOTQIHLH-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 116.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|