C20H23N5O4 — CID 67827969
3-[[3-[[(2S)-2-amino-3-(4-carbamimidoylphenyl)propanoyl]amino]benzoyl]amino]propanoic acid (PubChem CID 67827969) has the molecular formula C20H23N5O4 and a molecular weight of 397.44 g/mol. Its IUPAC name is 3-[[3-[[(2S)-2-amino-3-(4-carbamimidoylphenyl)propanoyl]amino]benzoyl]amino]propanoic acid.
| Compound Name | 3-[[3-[[(2S)-2-amino-3-(4-carbamimidoylphenyl)propanoyl]amino]benzoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 67827969 |
| Molecular Formula | C20H23N5O4 |
| Molecular Weight | 397.44 g/mol |
| Exact Mass | 397.18 |
| IUPAC Name | 3-[[3-[[(2S)-2-amino-3-(4-carbamimidoylphenyl)propanoyl]amino]benzoyl]amino]propanoic acid |
| SMILES | [H]/N=C(\N)c1ccc(C[C@H](N)C(=O)Nc2cccc(C(=O)NCCC(=O)O)c2)cc1 |
| InChI | InChI=1S/C20H23N5O4/c21-16(10-12-4-6-13(7-5-12)18(22)23)20(29)25-15-3-1-2-14(11-15)19(28)24-9-8-17(26)27/h1-7,11,16H,8-10,21H2,(H3,22,23)(H,24,28)(H,25,29)(H,26,27)/t16-/m0/s1 |
| InChIKey | BBTXJCGFPCHCFR-INIZCTEOSA-N |
| XLogP | 0.68 |
| TPSA | 171.39 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.44 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|