C22H28F3N3O8S2 — CID 87592024
[4-[(2S)-3-(3-carbamimidoylphenoxy)-2-(ethylsulfonylamino)propyl]phenyl] ethanesulfonate;2,2,2-trifluoroacetic acid (PubChem CID 87592024) has the molecular formula C22H28F3N3O8S2 and a molecular weight of 583.61 g/mol. Its IUPAC name is [4-[(2S)-3-(3-carbamimidoylphenoxy)-2-(ethylsulfonylamino)propyl]phenyl] ethanesulfonate;2,2,2-trifluoroacetic acid.
| Compound Name | [4-[(2S)-3-(3-carbamimidoylphenoxy)-2-(ethylsulfonylamino)propyl]phenyl] ethanesulfonate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 87592024 |
| Molecular Formula | C22H28F3N3O8S2 |
| Molecular Weight | 583.61 g/mol |
| Exact Mass | 583.13 |
| IUPAC Name | [4-[(2S)-3-(3-carbamimidoylphenoxy)-2-(ethylsulfonylamino)propyl]phenyl] ethanesulfonate;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.[H]/N=C(\N)c1cccc(OC[C@H](Cc2ccc(OS(=O)(=O)CC)cc2)NS(=O)(=O)CC)c1 |
| InChI | InChI=1S/C20H27N3O6S2.C2HF3O2/c1-3-30(24,25)23-17(14-28-19-7-5-6-16(13-19)20(21)22)12-15-8-10-18(11-9-15)29-31(26,27)4-2;3-2(4,5)1(6)7/h5-11,13,17,23H,3-4,12,14H2,1-2H3,(H3,21,22);(H,6,7)/t17-;/m0./s1 |
| InChIKey | YKWBNADCLMOPLS-LMOVPXPDSA-N |
| XLogP | 2.26 |
| TPSA | 185.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.61 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|