C39H40N4O6S — CID 59749374
benzyl 4-[4-[(2S)-3-(3-carbamimidoylphenoxy)-2-(naphthalen-2-ylsulfonylamino)propyl]phenoxy]piperidine-1-carboxylate (PubChem CID 59749374) has the molecular formula C39H40N4O6S and a molecular weight of 692.84 g/mol. Its IUPAC name is benzyl 4-[4-[(2S)-3-(3-carbamimidoylphenoxy)-2-(naphthalen-2-ylsulfonylamino)propyl]phenoxy]piperidine-1-carboxylate.
| Compound Name | benzyl 4-[4-[(2S)-3-(3-carbamimidoylphenoxy)-2-(naphthalen-2-ylsulfonylamino)propyl]phenoxy]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 59749374 |
| Molecular Formula | C39H40N4O6S |
| Molecular Weight | 692.84 g/mol |
| Exact Mass | 692.27 |
| IUPAC Name | benzyl 4-[4-[(2S)-3-(3-carbamimidoylphenoxy)-2-(naphthalen-2-ylsulfonylamino)propyl]phenoxy]piperidine-1-carboxylate |
| SMILES | [H]/N=C(\N)c1cccc(OC[C@H](Cc2ccc(OC3CCN(C(=O)OCc4ccccc4)CC3)cc2)NS(=O)(=O)c2ccc3ccccc3c2)c1 |
| InChI | InChI=1S/C39H40N4O6S/c40-38(41)32-11-6-12-36(24-32)47-27-33(42-50(45,46)37-18-15-30-9-4-5-10-31(30)25-37)23-28-13-16-34(17-14-28)49-35-19-21-43(22-20-35)39(44)48-26-29-7-2-1-3-8-29/h1-18,24-25,33,35,42H,19-23,26-27H2,(H3,40,41)/t33-/m0/s1 |
| InChIKey | TUXFVXIWERSJFU-XIFFEERXSA-N |
| XLogP | 6.27 |
| TPSA | 144.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.84 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|