C37H43ClN6O6S — CID 70081087
benzyl 4-[4-[(2R)-3-[(1-carbamimidoylpiperidin-3-yl)methylamino]-2-(naphthalen-2-ylsulfonylamino)-3-oxopropyl]anilino]-4-oxobutanoate;hydrochloride (PubChem CID 70081087) has the molecular formula C37H43ClN6O6S and a molecular weight of 735.31 g/mol. Its IUPAC name is benzyl 4-[4-[(2R)-3-[(1-carbamimidoylpiperidin-3-yl)methylamino]-2-(naphthalen-2-ylsulfonylamino)-3-oxopropyl]anilino]-4-oxobutanoate;hydrochloride.
| Compound Name | benzyl 4-[4-[(2R)-3-[(1-carbamimidoylpiperidin-3-yl)methylamino]-2-(naphthalen-2-ylsulfonylamino)-3-oxopropyl]anilino]-4-oxobutanoate;hydrochloride |
|---|---|
| PubChem CID | 70081087 |
| Molecular Formula | C37H43ClN6O6S |
| Molecular Weight | 735.31 g/mol |
| Exact Mass | 734.27 |
| IUPAC Name | benzyl 4-[4-[(2R)-3-[(1-carbamimidoylpiperidin-3-yl)methylamino]-2-(naphthalen-2-ylsulfonylamino)-3-oxopropyl]anilino]-4-oxobutanoate;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)N1CCCC(CNC(=O)[C@@H](Cc2ccc(NC(=O)CCC(=O)OCc3ccccc3)cc2)NS(=O)(=O)c2ccc3ccccc3c2)C1 |
| InChI | InChI=1S/C37H42N6O6S.ClH/c38-37(39)43-20-6-9-28(24-43)23-40-36(46)33(42-50(47,48)32-17-14-29-10-4-5-11-30(29)22-32)21-26-12-15-31(16-13-26)41-34(44)18-19-35(45)49-25-27-7-2-1-3-8-27;/h1-5,7-8,10-17,22,28,33,42H,6,9,18-21,23-25H2,(H3,38,39)(H,40,46)(H,41,44);1H/t28?,33-;/m1./s1 |
| InChIKey | BWMLOXXLMHIYDF-QPPGOLRFSA-N |
| XLogP | 4.33 |
| TPSA | 183.78 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 51 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 735.31 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|