C26H34N6O6S2 — CID 22848534
(2R)-3-(4-aminophenyl)-N-[(1-carbamimidoylpiperidin-3-yl)methyl]-2-(naphthalen-2-ylsulfonylamino)propanamide;sulfurous acid (PubChem CID 22848534) has the molecular formula C26H34N6O6S2 and a molecular weight of 590.73 g/mol. Its IUPAC name is (2R)-3-(4-aminophenyl)-N-[(1-carbamimidoylpiperidin-3-yl)methyl]-2-(naphthalen-2-ylsulfonylamino)propanamide;sulfurous acid.
| Compound Name | (2R)-3-(4-aminophenyl)-N-[(1-carbamimidoylpiperidin-3-yl)methyl]-2-(naphthalen-2-ylsulfonylamino)propanamide;sulfurous acid |
|---|---|
| PubChem CID | 22848534 |
| Molecular Formula | C26H34N6O6S2 |
| Molecular Weight | 590.73 g/mol |
| Exact Mass | 590.20 |
| IUPAC Name | (2R)-3-(4-aminophenyl)-N-[(1-carbamimidoylpiperidin-3-yl)methyl]-2-(naphthalen-2-ylsulfonylamino)propanamide;sulfurous acid |
| SMILES | O=S(O)O.[H]/N=C(\N)N1CCCC(CNC(=O)[C@@H](Cc2ccc(N)cc2)NS(=O)(=O)c2ccc3ccccc3c2)C1 |
| InChI | InChI=1S/C26H32N6O3S.H2O3S/c27-22-10-7-18(8-11-22)14-24(25(33)30-16-19-4-3-13-32(17-19)26(28)29)31-36(34,35)23-12-9-20-5-1-2-6-21(20)15-23;1-4(2)3/h1-2,5-12,15,19,24,31H,3-4,13-14,16-17,27H2,(H3,28,29)(H,30,33);(H2,1,2,3)/t19?,24-;/m1./s1 |
| InChIKey | MCLPTUKEJKHWQS-MBXXSUCOSA-N |
| XLogP | 1.71 |
| TPSA | 211.93 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.73 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|