C22H27IN6O5S — CID 22848530
(2R)-N-[[(3S)-1-carbamimidoylpiperidin-3-yl]methyl]-2-[(4-iodophenyl)sulfonylamino]-3-(4-nitrophenyl)propanamide (PubChem CID 22848530) has the molecular formula C22H27IN6O5S and a molecular weight of 614.47 g/mol. Its IUPAC name is (2R)-N-[[(3S)-1-carbamimidoylpiperidin-3-yl]methyl]-2-[(4-iodophenyl)sulfonylamino]-3-(4-nitrophenyl)propanamide.
| Compound Name | (2R)-N-[[(3S)-1-carbamimidoylpiperidin-3-yl]methyl]-2-[(4-iodophenyl)sulfonylamino]-3-(4-nitrophenyl)propanamide |
|---|---|
| PubChem CID | 22848530 |
| Molecular Formula | C22H27IN6O5S |
| Molecular Weight | 614.47 g/mol |
| Exact Mass | 614.08 |
| IUPAC Name | (2R)-N-[[(3S)-1-carbamimidoylpiperidin-3-yl]methyl]-2-[(4-iodophenyl)sulfonylamino]-3-(4-nitrophenyl)propanamide |
| SMILES | [H]/N=C(\N)N1CCC[C@@H](CNC(=O)[C@@H](Cc2ccc([N+](=O)[O-])cc2)NS(=O)(=O)c2ccc(I)cc2)C1 |
| InChI | InChI=1S/C22H27IN6O5S/c23-17-5-9-19(10-6-17)35(33,34)27-20(12-15-3-7-18(8-4-15)29(31)32)21(30)26-13-16-2-1-11-28(14-16)22(24)25/h3-10,16,20,27H,1-2,11-14H2,(H3,24,25)(H,26,30)/t16-,20+/m0/s1 |
| InChIKey | LWOANYVULDOLAQ-OXJNMPFZSA-N |
| XLogP | 1.81 |
| TPSA | 171.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.47 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|