C28H36N6O6S — CID 149432481
(2S)-2-[[4-[[(3S)-1-carbamimidoylpiperidin-3-yl]methylamino]-3-cyclopropyl-4-oxobutanoyl]amino]-2-[(4-phenylphenyl)sulfonylamino]acetic acid (PubChem CID 149432481) has the molecular formula C28H36N6O6S and a molecular weight of 584.70 g/mol. Its IUPAC name is (2S)-2-[[4-[[(3S)-1-carbamimidoylpiperidin-3-yl]methylamino]-3-cyclopropyl-4-oxobutanoyl]amino]-2-[(4-phenylphenyl)sulfonylamino]acetic acid.
| Compound Name | (2S)-2-[[4-[[(3S)-1-carbamimidoylpiperidin-3-yl]methylamino]-3-cyclopropyl-4-oxobutanoyl]amino]-2-[(4-phenylphenyl)sulfonylamino]acetic acid |
|---|---|
| PubChem CID | 149432481 |
| Molecular Formula | C28H36N6O6S |
| Molecular Weight | 584.70 g/mol |
| Exact Mass | 584.24 |
| IUPAC Name | (2S)-2-[[4-[[(3S)-1-carbamimidoylpiperidin-3-yl]methylamino]-3-cyclopropyl-4-oxobutanoyl]amino]-2-[(4-phenylphenyl)sulfonylamino]acetic acid |
| SMILES | [H]/N=C(\N)N1CCC[C@@H](CNC(=O)C(CC(=O)N[C@@H](NS(=O)(=O)c2ccc(-c3ccccc3)cc2)C(=O)O)C2CC2)C1 |
| InChI | InChI=1S/C28H36N6O6S/c29-28(30)34-14-4-5-18(17-34)16-31-26(36)23(21-8-9-21)15-24(35)32-25(27(37)38)33-41(39,40)22-12-10-20(11-13-22)19-6-2-1-3-7-19/h1-3,6-7,10-13,18,21,23,25,33H,4-5,8-9,14-17H2,(H3,29,30)(H,31,36)(H,32,35)(H,37,38)/t18-,23?,25-/m0/s1 |
| InChIKey | LRBIPQDCYXSILZ-WBPUULEKSA-N |
| XLogP | 1.30 |
| TPSA | 194.78 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.70 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|