C26H40N6O6S — CID 70049996
2-[[(2S)-2-[(4-tert-butylphenyl)sulfonylamino]-4-[[(3S)-1-carbamimidoylpiperidin-3-yl]methylamino]-4-oxobutanoyl]-cyclopropylamino]acetic acid (PubChem CID 70049996) has the molecular formula C26H40N6O6S and a molecular weight of 564.71 g/mol. Its IUPAC name is 2-[[(2S)-2-[(4-tert-butylphenyl)sulfonylamino]-4-[[(3S)-1-carbamimidoylpiperidin-3-yl]methylamino]-4-oxobutanoyl]-cyclopropylamino]acetic acid.
| Compound Name | 2-[[(2S)-2-[(4-tert-butylphenyl)sulfonylamino]-4-[[(3S)-1-carbamimidoylpiperidin-3-yl]methylamino]-4-oxobutanoyl]-cyclopropylamino]acetic acid |
|---|---|
| PubChem CID | 70049996 |
| Molecular Formula | C26H40N6O6S |
| Molecular Weight | 564.71 g/mol |
| Exact Mass | 564.27 |
| IUPAC Name | 2-[[(2S)-2-[(4-tert-butylphenyl)sulfonylamino]-4-[[(3S)-1-carbamimidoylpiperidin-3-yl]methylamino]-4-oxobutanoyl]-cyclopropylamino]acetic acid |
| SMILES | [H]/N=C(\N)N1CCC[C@@H](CNC(=O)C[C@H](NS(=O)(=O)c2ccc(C(C)(C)C)cc2)C(=O)N(CC(=O)O)C2CC2)C1 |
| InChI | InChI=1S/C26H40N6O6S/c1-26(2,3)18-6-10-20(11-7-18)39(37,38)30-21(24(36)32(16-23(34)35)19-8-9-19)13-22(33)29-14-17-5-4-12-31(15-17)25(27)28/h6-7,10-11,17,19,21,30H,4-5,8-9,12-16H2,1-3H3,(H3,27,28)(H,29,33)(H,34,35)/t17-,21-/m0/s1 |
| InChIKey | UKWPHDDNNZBLAI-UWJYYQICSA-N |
| XLogP | 0.82 |
| TPSA | 185.99 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.71 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|