C21H38N6O4 — CID 67746314
3-[[(2S)-2-(butylamino)-4-[[(3S)-1-carbamimidoylpiperidin-3-yl]methylamino]-4-oxobutanoyl]-cyclopropylamino]propanoic acid (PubChem CID 67746314) has the molecular formula C21H38N6O4 and a molecular weight of 438.57 g/mol. Its IUPAC name is 3-[[(2S)-2-(butylamino)-4-[[(3S)-1-carbamimidoylpiperidin-3-yl]methylamino]-4-oxobutanoyl]-cyclopropylamino]propanoic acid.
| Compound Name | 3-[[(2S)-2-(butylamino)-4-[[(3S)-1-carbamimidoylpiperidin-3-yl]methylamino]-4-oxobutanoyl]-cyclopropylamino]propanoic acid |
|---|---|
| PubChem CID | 67746314 |
| Molecular Formula | C21H38N6O4 |
| Molecular Weight | 438.57 g/mol |
| Exact Mass | 438.30 |
| IUPAC Name | 3-[[(2S)-2-(butylamino)-4-[[(3S)-1-carbamimidoylpiperidin-3-yl]methylamino]-4-oxobutanoyl]-cyclopropylamino]propanoic acid |
| SMILES | [H]/N=C(\N)N1CCC[C@@H](CNC(=O)C[C@H](NCCCC)C(=O)N(CCC(=O)O)C2CC2)C1 |
| InChI | InChI=1S/C21H38N6O4/c1-2-3-9-24-17(20(31)27(16-6-7-16)11-8-19(29)30)12-18(28)25-13-15-5-4-10-26(14-15)21(22)23/h15-17,24H,2-14H2,1H3,(H3,22,23)(H,25,28)(H,29,30)/t15-,17-/m0/s1 |
| InChIKey | KYDWNOCRBUDBRP-RDJZCZTQSA-N |
| XLogP | 0.32 |
| TPSA | 151.85 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.57 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|