C21H37ClN6O5 — CID 67746119
2-[cyclopropyl-[(2S)-4-[[(3S)-1-methanehydrazonoylpiperidin-3-yl]methylamino]-4-oxo-2-(pentanoylamino)butanoyl]amino]acetic acid;hydrochloride (PubChem CID 67746119) has the molecular formula C21H37ClN6O5 and a molecular weight of 489.02 g/mol. Its IUPAC name is 2-[cyclopropyl-[(2S)-4-[[(3S)-1-methanehydrazonoylpiperidin-3-yl]methylamino]-4-oxo-2-(pentanoylamino)butanoyl]amino]acetic acid;hydrochloride.
| Compound Name | 2-[cyclopropyl-[(2S)-4-[[(3S)-1-methanehydrazonoylpiperidin-3-yl]methylamino]-4-oxo-2-(pentanoylamino)butanoyl]amino]acetic acid;hydrochloride |
|---|---|
| PubChem CID | 67746119 |
| Molecular Formula | C21H37ClN6O5 |
| Molecular Weight | 489.02 g/mol |
| Exact Mass | 488.25 |
| IUPAC Name | 2-[cyclopropyl-[(2S)-4-[[(3S)-1-methanehydrazonoylpiperidin-3-yl]methylamino]-4-oxo-2-(pentanoylamino)butanoyl]amino]acetic acid;hydrochloride |
| SMILES | CCCCC(=O)N[C@@H](CC(=O)NC[C@@H]1CCCN(C=NN)C1)C(=O)N(CC(=O)O)C1CC1.Cl |
| InChI | InChI=1S/C21H36N6O5.ClH/c1-2-3-6-18(28)25-17(21(32)27(13-20(30)31)16-7-8-16)10-19(29)23-11-15-5-4-9-26(12-15)14-24-22;/h14-17H,2-13,22H2,1H3,(H,23,29)(H,25,28)(H,30,31);1H/t15-,17-;/m0./s1 |
| InChIKey | ACNXFVRJEVKZAB-NBLXOJGSSA-N |
| XLogP | 0.28 |
| TPSA | 157.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.02 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|