C23H33ClN6O7 — CID 67746208
2-[cyclopropyl-[4-[[(2S)-4-methanehydrazonoylmorpholin-2-yl]methylamino]-4-oxo-2-(phenylmethoxycarbonylamino)butanoyl]amino]acetic acid;hydrochloride (PubChem CID 67746208) has the molecular formula C23H33ClN6O7 and a molecular weight of 541.01 g/mol. Its IUPAC name is 2-[cyclopropyl-[4-[[(2S)-4-methanehydrazonoylmorpholin-2-yl]methylamino]-4-oxo-2-(phenylmethoxycarbonylamino)butanoyl]amino]acetic acid;hydrochloride.
| Compound Name | 2-[cyclopropyl-[4-[[(2S)-4-methanehydrazonoylmorpholin-2-yl]methylamino]-4-oxo-2-(phenylmethoxycarbonylamino)butanoyl]amino]acetic acid;hydrochloride |
|---|---|
| PubChem CID | 67746208 |
| Molecular Formula | C23H33ClN6O7 |
| Molecular Weight | 541.01 g/mol |
| Exact Mass | 540.21 |
| IUPAC Name | 2-[cyclopropyl-[4-[[(2S)-4-methanehydrazonoylmorpholin-2-yl]methylamino]-4-oxo-2-(phenylmethoxycarbonylamino)butanoyl]amino]acetic acid;hydrochloride |
| SMILES | Cl.NN=CN1CCO[C@@H](CNC(=O)CC(NC(=O)OCc2ccccc2)C(=O)N(CC(=O)O)C2CC2)C1 |
| InChI | InChI=1S/C23H32N6O7.ClH/c24-26-15-28-8-9-35-18(12-28)11-25-20(30)10-19(22(33)29(13-21(31)32)17-6-7-17)27-23(34)36-14-16-4-2-1-3-5-16;/h1-5,15,17-19H,6-14,24H2,(H,25,30)(H,27,34)(H,31,32);1H/t18-,19?;/m0./s1 |
| InChIKey | MMKHHLHLWHUCGJ-HMEPSURWSA-N |
| XLogP | -0.11 |
| TPSA | 175.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.01 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|