C28H39F3N6O11S — CID 67734271
methyl 2-[[1-[cyclopropyl-(3-ethoxy-3-oxopropyl)amino]-4-[[(2S)-4-methanehydrazonoylmorpholin-2-yl]methylamino]-1,4-dioxobutan-2-yl]sulfamoyl]benzoate;2,2,2-trifluoroacetic acid (PubChem CID 67734271) has the molecular formula C28H39F3N6O11S and a molecular weight of 724.71 g/mol. Its IUPAC name is methyl 2-[[1-[cyclopropyl-(3-ethoxy-3-oxopropyl)amino]-4-[[(2S)-4-methanehydrazonoylmorpholin-2-yl]methylamino]-1,4-dioxobutan-2-yl]sulfamoyl]benzoate;2,2,2-trifluoroacetic acid.
| Compound Name | methyl 2-[[1-[cyclopropyl-(3-ethoxy-3-oxopropyl)amino]-4-[[(2S)-4-methanehydrazonoylmorpholin-2-yl]methylamino]-1,4-dioxobutan-2-yl]sulfamoyl]benzoate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 67734271 |
| Molecular Formula | C28H39F3N6O11S |
| Molecular Weight | 724.71 g/mol |
| Exact Mass | 724.23 |
| IUPAC Name | methyl 2-[[1-[cyclopropyl-(3-ethoxy-3-oxopropyl)amino]-4-[[(2S)-4-methanehydrazonoylmorpholin-2-yl]methylamino]-1,4-dioxobutan-2-yl]sulfamoyl]benzoate;2,2,2-trifluoroacetic acid |
| SMILES | CCOC(=O)CCN(C(=O)C(CC(=O)NC[C@H]1CN(C=NN)CCO1)NS(=O)(=O)c1ccccc1C(=O)OC)C1CC1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C26H38N6O9S.C2HF3O2/c1-3-40-24(34)10-11-32(18-8-9-18)25(35)21(14-23(33)28-15-19-16-31(17-29-27)12-13-41-19)30-42(37,38)22-7-5-4-6-20(22)26(36)39-2;3-2(4,5)1(6)7/h4-7,17-19,21,30H,3,8-16,27H2,1-2H3,(H,28,33);(H,6,7)/t19-,21?;/m0./s1 |
| InChIKey | CVXZVIHVVMBSOF-AUFHPKEVSA-N |
| XLogP | -0.19 |
| TPSA | 236.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.71 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|