C30H42ClN7O7S — CID 67674868
acetic acid;(2S)-N-[2-[(2-chloroacetyl)amino]ethyl]-N-cyclopropyl-N'-[[(3S)-1-methanehydrazonoylpiperidin-3-yl]methyl]-2-(naphthalen-2-ylsulfonylamino)butanediamide (PubChem CID 67674868) has the molecular formula C30H42ClN7O7S and a molecular weight of 680.23 g/mol. Its IUPAC name is acetic acid;(2S)-N-[2-[(2-chloroacetyl)amino]ethyl]-N-cyclopropyl-N'-[[(3S)-1-methanehydrazonoylpiperidin-3-yl]methyl]-2-(naphthalen-2-ylsulfonylamino)butanediamide.
| Compound Name | acetic acid;(2S)-N-[2-[(2-chloroacetyl)amino]ethyl]-N-cyclopropyl-N'-[[(3S)-1-methanehydrazonoylpiperidin-3-yl]methyl]-2-(naphthalen-2-ylsulfonylamino)butanediamide |
|---|---|
| PubChem CID | 67674868 |
| Molecular Formula | C30H42ClN7O7S |
| Molecular Weight | 680.23 g/mol |
| Exact Mass | 679.26 |
| IUPAC Name | acetic acid;(2S)-N-[2-[(2-chloroacetyl)amino]ethyl]-N-cyclopropyl-N'-[[(3S)-1-methanehydrazonoylpiperidin-3-yl]methyl]-2-(naphthalen-2-ylsulfonylamino)butanediamide |
| SMILES | CC(=O)O.NN=CN1CCC[C@@H](CNC(=O)C[C@H](NS(=O)(=O)c2ccc3ccccc3c2)C(=O)N(CCNC(=O)CCl)C2CC2)C1 |
| InChI | InChI=1S/C28H38ClN7O5S.C2H4O2/c29-16-27(38)31-11-13-36(23-8-9-23)28(39)25(15-26(37)32-17-20-4-3-12-35(18-20)19-33-30)34-42(40,41)24-10-7-21-5-1-2-6-22(21)14-24;1-2(3)4/h1-2,5-7,10,14,19-20,23,25,34H,3-4,8-9,11-13,15-18,30H2,(H,31,38)(H,32,37);1H3,(H,3,4)/t20-,25-;/m0./s1 |
| InChIKey | RFCIEWMOYWWSBS-VMZNWUEUSA-N |
| XLogP | 1.04 |
| TPSA | 203.60 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.23 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|