C31H43N7O7S — CID 67674293
acetic acid;(2S)-N-cyclopropyl-N-(cyclopropylcarbamoyl)-N'-[[(3S)-1-methanehydrazonoylpiperidin-3-yl]methyl]-N'-methyl-2-(naphthalen-2-ylsulfonylamino)butanediamide (PubChem CID 67674293) has the molecular formula C31H43N7O7S and a molecular weight of 657.79 g/mol. Its IUPAC name is acetic acid;(2S)-N-cyclopropyl-N-(cyclopropylcarbamoyl)-N'-[[(3S)-1-methanehydrazonoylpiperidin-3-yl]methyl]-N'-methyl-2-(naphthalen-2-ylsulfonylamino)butanediamide.
| Compound Name | acetic acid;(2S)-N-cyclopropyl-N-(cyclopropylcarbamoyl)-N'-[[(3S)-1-methanehydrazonoylpiperidin-3-yl]methyl]-N'-methyl-2-(naphthalen-2-ylsulfonylamino)butanediamide |
|---|---|
| PubChem CID | 67674293 |
| Molecular Formula | C31H43N7O7S |
| Molecular Weight | 657.79 g/mol |
| Exact Mass | 657.29 |
| IUPAC Name | acetic acid;(2S)-N-cyclopropyl-N-(cyclopropylcarbamoyl)-N'-[[(3S)-1-methanehydrazonoylpiperidin-3-yl]methyl]-N'-methyl-2-(naphthalen-2-ylsulfonylamino)butanediamide |
| SMILES | CC(=O)O.CN(C[C@H]1CCCN(C=NN)C1)C(=O)C[C@H](NS(=O)(=O)c1ccc2ccccc2c1)C(=O)N(C(=O)NC1CC1)C1CC1 |
| InChI | InChI=1S/C29H39N7O5S.C2H4O2/c1-34(17-20-5-4-14-35(18-20)19-31-30)27(37)16-26(28(38)36(24-11-12-24)29(39)32-23-9-10-23)33-42(40,41)25-13-8-21-6-2-3-7-22(21)15-25;1-2(3)4/h2-3,6-8,13,15,19-20,23-24,26,33H,4-5,9-12,14,16-18,30H2,1H3,(H,32,39);1H3,(H,3,4)/t20-,26+;/m1./s1 |
| InChIKey | OEVYLRXDUXEKDH-SAPHTPTLSA-N |
| XLogP | 1.90 |
| TPSA | 194.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.79 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|