C25H35N5O4S2 — CID 67766511
N-[3-hydroxy-1-[2-[(1-methanehydrazonoylpiperidin-3-yl)methylsulfanylmethyl]pyrrolidin-1-yl]-1-oxopropan-2-yl]naphthalene-2-sulfonamide (PubChem CID 67766511) has the molecular formula C25H35N5O4S2 and a molecular weight of 533.72 g/mol. Its IUPAC name is N-[3-hydroxy-1-[2-[(1-methanehydrazonoylpiperidin-3-yl)methylsulfanylmethyl]pyrrolidin-1-yl]-1-oxopropan-2-yl]naphthalene-2-sulfonamide.
| Compound Name | N-[3-hydroxy-1-[2-[(1-methanehydrazonoylpiperidin-3-yl)methylsulfanylmethyl]pyrrolidin-1-yl]-1-oxopropan-2-yl]naphthalene-2-sulfonamide |
|---|---|
| PubChem CID | 67766511 |
| Molecular Formula | C25H35N5O4S2 |
| Molecular Weight | 533.72 g/mol |
| Exact Mass | 533.21 |
| IUPAC Name | N-[3-hydroxy-1-[2-[(1-methanehydrazonoylpiperidin-3-yl)methylsulfanylmethyl]pyrrolidin-1-yl]-1-oxopropan-2-yl]naphthalene-2-sulfonamide |
| SMILES | NN=CN1CCCC(CSCC2CCCN2C(=O)C(CO)NS(=O)(=O)c2ccc3ccccc3c2)C1 |
| InChI | InChI=1S/C25H35N5O4S2/c26-27-18-29-11-3-5-19(14-29)16-35-17-22-8-4-12-30(22)25(32)24(15-31)28-36(33,34)23-10-9-20-6-1-2-7-21(20)13-23/h1-2,6-7,9-10,13,18-19,22,24,28,31H,3-5,8,11-12,14-17,26H2 |
| InChIKey | QQDRCHUISGXIMP-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 128.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.72 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|