C25H35N5O5S — CID 70062329
4-[[(2S)-1-[(2S)-3-hydroxy-2-(naphthalen-2-ylsulfonylamino)propanoyl]pyrrolidin-2-yl]methoxymethyl]piperidine-1-carboximidamide (PubChem CID 70062329) has the molecular formula C25H35N5O5S and a molecular weight of 517.65 g/mol. Its IUPAC name is 4-[[(2S)-1-[(2S)-3-hydroxy-2-(naphthalen-2-ylsulfonylamino)propanoyl]pyrrolidin-2-yl]methoxymethyl]piperidine-1-carboximidamide.
| Compound Name | 4-[[(2S)-1-[(2S)-3-hydroxy-2-(naphthalen-2-ylsulfonylamino)propanoyl]pyrrolidin-2-yl]methoxymethyl]piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 70062329 |
| Molecular Formula | C25H35N5O5S |
| Molecular Weight | 517.65 g/mol |
| Exact Mass | 517.24 |
| IUPAC Name | 4-[[(2S)-1-[(2S)-3-hydroxy-2-(naphthalen-2-ylsulfonylamino)propanoyl]pyrrolidin-2-yl]methoxymethyl]piperidine-1-carboximidamide |
| SMILES | [H]/N=C(\N)N1CCC(COC[C@@H]2CCCN2C(=O)[C@H](CO)NS(=O)(=O)c2ccc3ccccc3c2)CC1 |
| InChI | InChI=1S/C25H35N5O5S/c26-25(27)29-12-9-18(10-13-29)16-35-17-21-6-3-11-30(21)24(32)23(15-31)28-36(33,34)22-8-7-19-4-1-2-5-20(19)14-22/h1-2,4-5,7-8,14,18,21,23,28,31H,3,6,9-13,15-17H2,(H3,26,27)/t21-,23-/m0/s1 |
| InChIKey | YTTQTBYNVQWPMQ-GMAHTHKFSA-N |
| XLogP | 1.09 |
| TPSA | 149.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.65 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|