C26H37ClN6O6S — CID 67672887
ethyl 2-[[(2S)-4-amino-2-(naphthalen-2-ylsulfonylamino)-4-oxobutanoyl]-methylamino]-2-[(3S)-1-carbamimidoylpiperidin-3-yl]propanoate;hydrochloride (PubChem CID 67672887) has the molecular formula C26H37ClN6O6S and a molecular weight of 597.14 g/mol. Its IUPAC name is ethyl 2-[[(2S)-4-amino-2-(naphthalen-2-ylsulfonylamino)-4-oxobutanoyl]-methylamino]-2-[(3S)-1-carbamimidoylpiperidin-3-yl]propanoate;hydrochloride.
| Compound Name | ethyl 2-[[(2S)-4-amino-2-(naphthalen-2-ylsulfonylamino)-4-oxobutanoyl]-methylamino]-2-[(3S)-1-carbamimidoylpiperidin-3-yl]propanoate;hydrochloride |
|---|---|
| PubChem CID | 67672887 |
| Molecular Formula | C26H37ClN6O6S |
| Molecular Weight | 597.14 g/mol |
| Exact Mass | 596.22 |
| IUPAC Name | ethyl 2-[[(2S)-4-amino-2-(naphthalen-2-ylsulfonylamino)-4-oxobutanoyl]-methylamino]-2-[(3S)-1-carbamimidoylpiperidin-3-yl]propanoate;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)N1CCC[C@H](C(C)(C(=O)OCC)N(C)C(=O)[C@H](CC(N)=O)NS(=O)(=O)c2ccc3ccccc3c2)C1 |
| InChI | InChI=1S/C26H36N6O6S.ClH/c1-4-38-24(35)26(2,19-10-7-13-32(16-19)25(28)29)31(3)23(34)21(15-22(27)33)30-39(36,37)20-12-11-17-8-5-6-9-18(17)14-20;/h5-6,8-9,11-12,14,19,21,30H,4,7,10,13,15-16H2,1-3H3,(H2,27,33)(H3,28,29);1H/t19-,21-,26?;/m0./s1 |
| InChIKey | UKXBEYOSETXCES-BVLMDOANSA-N |
| XLogP | 1.17 |
| TPSA | 188.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.14 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|