C26H30N6O5S — CID 67629269
(2S)-N-(1-carbamimidoylpiperidin-3-yl)-N-methyl-2-(naphthalen-2-ylsulfonylamino)-3-(3-nitrophenyl)propanamide (PubChem CID 67629269) has the molecular formula C26H30N6O5S and a molecular weight of 538.63 g/mol. Its IUPAC name is (2S)-N-(1-carbamimidoylpiperidin-3-yl)-N-methyl-2-(naphthalen-2-ylsulfonylamino)-3-(3-nitrophenyl)propanamide.
| Compound Name | (2S)-N-(1-carbamimidoylpiperidin-3-yl)-N-methyl-2-(naphthalen-2-ylsulfonylamino)-3-(3-nitrophenyl)propanamide |
|---|---|
| PubChem CID | 67629269 |
| Molecular Formula | C26H30N6O5S |
| Molecular Weight | 538.63 g/mol |
| Exact Mass | 538.20 |
| IUPAC Name | (2S)-N-(1-carbamimidoylpiperidin-3-yl)-N-methyl-2-(naphthalen-2-ylsulfonylamino)-3-(3-nitrophenyl)propanamide |
| SMILES | [H]/N=C(\N)N1CCCC(N(C)C(=O)[C@H](Cc2cccc([N+](=O)[O-])c2)NS(=O)(=O)c2ccc3ccccc3c2)C1 |
| InChI | InChI=1S/C26H30N6O5S/c1-30(22-10-5-13-31(17-22)26(27)28)25(33)24(15-18-6-4-9-21(14-18)32(34)35)29-38(36,37)23-12-11-19-7-2-3-8-20(19)16-23/h2-4,6-9,11-12,14,16,22,24,29H,5,10,13,15,17H2,1H3,(H3,27,28)/t22?,24-/m0/s1 |
| InChIKey | WVRHCVRNDMRPDE-GITCGBDTSA-N |
| XLogP | 2.45 |
| TPSA | 162.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.63 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|