C33H42N6O8S — CID 160983142
acetic acid;methyl (2R)-2-[[(2S)-4-[[(3S)-1-carbamimidoylpiperidin-3-yl]methylamino]-2-(naphthalen-2-ylsulfonylamino)-4-oxobutanoyl]amino]-3-phenylpropanoate (PubChem CID 160983142) has the molecular formula C33H42N6O8S and a molecular weight of 682.80 g/mol. Its IUPAC name is acetic acid;methyl (2R)-2-[[(2S)-4-[[(3S)-1-carbamimidoylpiperidin-3-yl]methylamino]-2-(naphthalen-2-ylsulfonylamino)-4-oxobutanoyl]amino]-3-phenylpropanoate.
| Compound Name | acetic acid;methyl (2R)-2-[[(2S)-4-[[(3S)-1-carbamimidoylpiperidin-3-yl]methylamino]-2-(naphthalen-2-ylsulfonylamino)-4-oxobutanoyl]amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 160983142 |
| Molecular Formula | C33H42N6O8S |
| Molecular Weight | 682.80 g/mol |
| Exact Mass | 682.28 |
| IUPAC Name | acetic acid;methyl (2R)-2-[[(2S)-4-[[(3S)-1-carbamimidoylpiperidin-3-yl]methylamino]-2-(naphthalen-2-ylsulfonylamino)-4-oxobutanoyl]amino]-3-phenylpropanoate |
| SMILES | CC(=O)O.[H]/N=C(\N)N1CCC[C@@H](CNC(=O)C[C@H](NS(=O)(=O)c2ccc3ccccc3c2)C(=O)N[C@H](Cc2ccccc2)C(=O)OC)C1 |
| InChI | InChI=1S/C31H38N6O6S.C2H4O2/c1-43-30(40)27(16-21-8-3-2-4-9-21)35-29(39)26(18-28(38)34-19-22-10-7-15-37(20-22)31(32)33)36-44(41,42)25-14-13-23-11-5-6-12-24(23)17-25;1-2(3)4/h2-6,8-9,11-14,17,22,26-27,36H,7,10,15-16,18-20H2,1H3,(H3,32,33)(H,34,38)(H,35,39);1H3,(H,3,4)/t22-,26-,27+;/m0./s1 |
| InChIKey | SZTVHFZACZEKSK-GEWISZGXSA-N |
| XLogP | 1.59 |
| TPSA | 221.08 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.80 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|