C28H33ClN6O3S — CID 45261837
(2R)-N-[(1-carbamimidoylpiperidin-3-yl)methyl]-3-(1H-indol-3-yl)-2-(naphthalen-2-ylsulfonylamino)propanamide;hydrochloride (PubChem CID 45261837) has the molecular formula C28H33ClN6O3S and a molecular weight of 569.13 g/mol. Its IUPAC name is (2R)-N-[(1-carbamimidoylpiperidin-3-yl)methyl]-3-(1H-indol-3-yl)-2-(naphthalen-2-ylsulfonylamino)propanamide;hydrochloride.
| Compound Name | (2R)-N-[(1-carbamimidoylpiperidin-3-yl)methyl]-3-(1H-indol-3-yl)-2-(naphthalen-2-ylsulfonylamino)propanamide;hydrochloride |
|---|---|
| PubChem CID | 45261837 |
| Molecular Formula | C28H33ClN6O3S |
| Molecular Weight | 569.13 g/mol |
| Exact Mass | 568.20 |
| IUPAC Name | (2R)-N-[(1-carbamimidoylpiperidin-3-yl)methyl]-3-(1H-indol-3-yl)-2-(naphthalen-2-ylsulfonylamino)propanamide;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)N1CCCC(CNC(=O)[C@@H](Cc2c[nH]c3ccccc23)NS(=O)(=O)c2ccc3ccccc3c2)C1 |
| InChI | InChI=1S/C28H32N6O3S.ClH/c29-28(30)34-13-5-6-19(18-34)16-32-27(35)26(15-22-17-31-25-10-4-3-9-24(22)25)33-38(36,37)23-12-11-20-7-1-2-8-21(20)14-23;/h1-4,7-12,14,17,19,26,31,33H,5-6,13,15-16,18H2,(H3,29,30)(H,32,35);1H/t19?,26-;/m1./s1 |
| InChIKey | HVLSJACRSUDQQE-ZMAGUBGDSA-N |
| XLogP | 3.35 |
| TPSA | 144.17 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.13 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|