C24H30ClN7O5S — CID 70049296
(2R)-N-[(1-carbamimidoylpiperidin-3-yl)methyl]-3-(1H-indol-3-yl)-2-[(4-nitrophenyl)sulfonylamino]propanamide;hydrochloride (PubChem CID 70049296) has the molecular formula C24H30ClN7O5S and a molecular weight of 564.07 g/mol. Its IUPAC name is (2R)-N-[(1-carbamimidoylpiperidin-3-yl)methyl]-3-(1H-indol-3-yl)-2-[(4-nitrophenyl)sulfonylamino]propanamide;hydrochloride.
| Compound Name | (2R)-N-[(1-carbamimidoylpiperidin-3-yl)methyl]-3-(1H-indol-3-yl)-2-[(4-nitrophenyl)sulfonylamino]propanamide;hydrochloride |
|---|---|
| PubChem CID | 70049296 |
| Molecular Formula | C24H30ClN7O5S |
| Molecular Weight | 564.07 g/mol |
| Exact Mass | 563.17 |
| IUPAC Name | (2R)-N-[(1-carbamimidoylpiperidin-3-yl)methyl]-3-(1H-indol-3-yl)-2-[(4-nitrophenyl)sulfonylamino]propanamide;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)N1CCCC(CNC(=O)[C@@H](Cc2c[nH]c3ccccc23)NS(=O)(=O)c2ccc([N+](=O)[O-])cc2)C1 |
| InChI | InChI=1S/C24H29N7O5S.ClH/c25-24(26)30-11-3-4-16(15-30)13-28-23(32)22(12-17-14-27-21-6-2-1-5-20(17)21)29-37(35,36)19-9-7-18(8-10-19)31(33)34;/h1-2,5-10,14,16,22,27,29H,3-4,11-13,15H2,(H3,25,26)(H,28,32);1H/t16?,22-;/m1./s1 |
| InChIKey | SJYJOIBXJOUFAJ-HFQSYZAFSA-N |
| XLogP | 2.11 |
| TPSA | 187.31 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.07 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|