C27H32N6O7S2 — CID 70046872
(2R)-N-[(4-carbamimidoylmorpholin-2-yl)methyl]-3-(1H-indol-3-yl)-2-(naphthalen-2-ylsulfonylamino)propanamide;sulfurous acid (PubChem CID 70046872) has the molecular formula C27H32N6O7S2 and a molecular weight of 616.72 g/mol. Its IUPAC name is (2R)-N-[(4-carbamimidoylmorpholin-2-yl)methyl]-3-(1H-indol-3-yl)-2-(naphthalen-2-ylsulfonylamino)propanamide;sulfurous acid.
| Compound Name | (2R)-N-[(4-carbamimidoylmorpholin-2-yl)methyl]-3-(1H-indol-3-yl)-2-(naphthalen-2-ylsulfonylamino)propanamide;sulfurous acid |
|---|---|
| PubChem CID | 70046872 |
| Molecular Formula | C27H32N6O7S2 |
| Molecular Weight | 616.72 g/mol |
| Exact Mass | 616.18 |
| IUPAC Name | (2R)-N-[(4-carbamimidoylmorpholin-2-yl)methyl]-3-(1H-indol-3-yl)-2-(naphthalen-2-ylsulfonylamino)propanamide;sulfurous acid |
| SMILES | O=S(O)O.[H]/N=C(\N)N1CCOC(CNC(=O)[C@@H](Cc2c[nH]c3ccccc23)NS(=O)(=O)c2ccc3ccccc3c2)C1 |
| InChI | InChI=1S/C27H30N6O4S.H2O3S/c28-27(29)33-11-12-37-21(17-33)16-31-26(34)25(14-20-15-30-24-8-4-3-7-23(20)24)32-38(35,36)22-10-9-18-5-1-2-6-19(18)13-22;1-4(2)3/h1-10,13,15,21,25,30,32H,11-12,14,16-17H2,(H3,28,29)(H,31,34);(H2,1,2,3)/t21?,25-;/m1./s1 |
| InChIKey | RGNVEHRPNYINBC-OILAERQVSA-N |
| XLogP | 1.60 |
| TPSA | 210.93 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.72 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|