C35H39ClN6O4S — CID 70048757
(2R)-N-[(1-carbamimidoylpiperidin-3-yl)methyl]-3-(1H-indol-3-yl)-2-[(6-phenylmethoxynaphthalen-2-yl)sulfonylamino]propanamide;hydrochloride (PubChem CID 70048757) has the molecular formula C35H39ClN6O4S and a molecular weight of 675.26 g/mol. Its IUPAC name is (2R)-N-[(1-carbamimidoylpiperidin-3-yl)methyl]-3-(1H-indol-3-yl)-2-[(6-phenylmethoxynaphthalen-2-yl)sulfonylamino]propanamide;hydrochloride.
| Compound Name | (2R)-N-[(1-carbamimidoylpiperidin-3-yl)methyl]-3-(1H-indol-3-yl)-2-[(6-phenylmethoxynaphthalen-2-yl)sulfonylamino]propanamide;hydrochloride |
|---|---|
| PubChem CID | 70048757 |
| Molecular Formula | C35H39ClN6O4S |
| Molecular Weight | 675.26 g/mol |
| Exact Mass | 674.24 |
| IUPAC Name | (2R)-N-[(1-carbamimidoylpiperidin-3-yl)methyl]-3-(1H-indol-3-yl)-2-[(6-phenylmethoxynaphthalen-2-yl)sulfonylamino]propanamide;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)N1CCCC(CNC(=O)[C@@H](Cc2c[nH]c3ccccc23)NS(=O)(=O)c2ccc3cc(OCc4ccccc4)ccc3c2)C1 |
| InChI | InChI=1S/C35H38N6O4S.ClH/c36-35(37)41-16-6-9-25(22-41)20-39-34(42)33(19-28-21-38-32-11-5-4-10-31(28)32)40-46(43,44)30-15-13-26-17-29(14-12-27(26)18-30)45-23-24-7-2-1-3-8-24;/h1-5,7-8,10-15,17-18,21,25,33,38,40H,6,9,16,19-20,22-23H2,(H3,36,37)(H,39,42);1H/t25?,33-;/m1./s1 |
| InChIKey | SYOLCVQTQSZJEZ-DLMAOAOQSA-N |
| XLogP | 4.93 |
| TPSA | 153.40 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.26 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|