C27H30N6O4S — CID 19081080
N-[(4-carbamimidoylmorpholin-2-yl)methyl]-3-(1H-indol-3-yl)-2-(naphthalen-2-ylsulfonylamino)propanamide (PubChem CID 19081080) has the molecular formula C27H30N6O4S and a molecular weight of 534.64 g/mol. Its IUPAC name is N-[(4-carbamimidoylmorpholin-2-yl)methyl]-3-(1H-indol-3-yl)-2-(naphthalen-2-ylsulfonylamino)propanamide.
| Compound Name | N-[(4-carbamimidoylmorpholin-2-yl)methyl]-3-(1H-indol-3-yl)-2-(naphthalen-2-ylsulfonylamino)propanamide |
|---|---|
| PubChem CID | 19081080 |
| Molecular Formula | C27H30N6O4S |
| Molecular Weight | 534.64 g/mol |
| Exact Mass | 534.20 |
| IUPAC Name | N-[(4-carbamimidoylmorpholin-2-yl)methyl]-3-(1H-indol-3-yl)-2-(naphthalen-2-ylsulfonylamino)propanamide |
| SMILES | [H]/N=C(\N)N1CCOC(CNC(=O)C(Cc2c[nH]c3ccccc23)NS(=O)(=O)c2ccc3ccccc3c2)C1 |
| InChI | InChI=1S/C27H30N6O4S/c28-27(29)33-11-12-37-21(17-33)16-31-26(34)25(14-20-15-30-24-8-4-3-7-23(20)24)32-38(35,36)22-10-9-18-5-1-2-6-19(18)13-22/h1-10,13,15,21,25,30,32H,11-12,14,16-17H2,(H3,28,29)(H,31,34) |
| InChIKey | BLCQGMIZZVLTDR-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 153.40 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.64 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|